C23H23N3O3 — CID 73321222
11-methoxy-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 73321222) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 11-methoxy-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | 11-methoxy-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 73321222 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 11-methoxy-14,20-dioxa-5,7,27-triazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | COc1ccc2cc1COCC=CCCOc1cccc(c1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C23H23N3O3/c1-27-22-9-8-19-14-18(22)16-28-12-3-2-4-13-29-20-7-5-6-17(15-20)21-10-11-24-23(25-19)26-21/h2-3,5-11,14-15H,4,12-13,16H2,1H3,(H,24,25,26) |
| InChIKey | HQKBTTAFASOYDG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|