C19H16N4O5 — CID 73322023
1,3-dimethyl-5-(4-nitrophenyl)-8,9-dihydro-7H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 73322023) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-nitrophenyl)-8,9-dihydro-7H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-(4-nitrophenyl)-8,9-dihydro-7H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 73322023 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1,3-dimethyl-5-(4-nitrophenyl)-8,9-dihydro-7H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | Cn1c(=O)c2c(-c3ccc([N+](=O)[O-])cc3)c3c(nc2n(C)c1=O)CCCC3=O |
| InChI | InChI=1S/C19H16N4O5/c1-21-17-16(18(25)22(2)19(21)26)14(10-6-8-11(9-7-10)23(27)28)15-12(20-17)4-3-5-13(15)24/h6-9H,3-5H2,1-2H3 |
| InChIKey | IYRLJFOUSWHGHN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 117.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|