C14H18N6O2 — CID 7332442
(3aR,7aR)-2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 7332442) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is (3aR,7aR)-2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7332442 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3aR,7aR)-2-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CN(C)c1nc(N)nc(CN2C(=O)[C@@H]3CC=CC[C@H]3C2=O)n1 |
| InChI | InChI=1S/C14H18N6O2/c1-19(2)14-17-10(16-13(15)18-14)7-20-11(21)8-5-3-4-6-9(8)12(20)22/h3-4,8-9H,5-7H2,1-2H3,(H2,15,16,17,18)/t8-,9-/m1/s1 |
| InChIKey | LQFBCDVGQQDJKM-RKDXNWHRSA-N |
| XLogP | -0.03 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|