2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid

C25H37NO3 — CID 73324766

IUPAC2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid
SMILESCCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(C)C(=O)O
InChIInChI=1S/C25H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(27)26-23(2)25(28)29/h4-5,7-8,10-11,13-14,16-17,19-20,23H,3,6,9,12,15,18,21-22H2,1-2H3,(H,26,27)(H,28,29)
InChIKeyBHZOQBQXELCPJM-UHFFFAOYSA-N
MW399.58 g/mol
LogP6.05
Rot. Bonds16

About 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid

2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid (PubChem CID 73324766) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid.

Molecular Properties

Compound Name2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid
PubChem CID73324766
Molecular FormulaC25H37NO3
Molecular Weight399.58 g/mol
Exact Mass399.28
IUPAC Name2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid
SMILESCCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(C)C(=O)O
InChIInChI=1S/C25H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(27)26-23(2)25(28)29/h4-5,7-8,10-11,13-14,16-17,19-20,23H,3,6,9,12,15,18,21-22H2,1-2H3,(H,26,27)(H,28,29)
InChIKeyBHZOQBQXELCPJM-UHFFFAOYSA-N
XLogP6.05
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds16
Heavy Atoms29
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500399.58
LogP ≤ 56.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid?
The IUPAC name of 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid (CID 73324766) is 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid.
What is the SMILES notation for 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid?
The canonical SMILES for 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid is CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(C)C(=O)O.
What is the InChIKey of 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid?
The InChIKey is BHZOQBQXELCPJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H37NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(27)26-23(2)25(28)29/h4-5,7-8,10-11,13-14,16-17,19-20,23H,3,6,9,12,15,18,21-22H2,1-2H3,(H,26,27)(H,28,29).
What are the key properties of 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid?
2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid has a molecular weight of 399.58 g/mol, XLogP of 6.05, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(docosa-4,7,10,13,16,19-hexaenoylamino)propanoic acid is sourced from PubChem (CID 73324766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).