About bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate
bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate (PubChem CID 73325278) has the molecular formula C21H24BrNO6
and a molecular weight of 466.33 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
| PubChem CID | 73325278 |
| Molecular Formula | C21H24BrNO6 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)C1C(=NO)CC(C)(O)C(C(=O)OCC=C)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H24BrNO6/c1-4-10-28-19(24)17-15(23-27)12-21(3,26)18(20(25)29-11-5-2)16(17)13-6-8-14(22)9-7-13/h4-9,16-18,26-27H,1-2,10-12H2,3H3 |
| InChIKey | QWGGBHGFMADIOT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate?
The IUPAC name of bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate (CID 73325278) is bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate.
What is the SMILES notation for bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate?
The canonical SMILES for bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate is C=CCOC(=O)C1C(=NO)CC(C)(O)C(C(=O)OCC=C)C1c1ccc(Br)cc1.
What is the InChIKey of bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate?
The InChIKey is QWGGBHGFMADIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BrNO6/c1-4-10-28-19(24)17-15(23-27)12-21(3,26)18(20(25)29-11-5-2)16(17)13-6-8-14(22)9-7-13/h4-9,16-18,26-27H,1-2,10-12H2,3H3.
What are the key properties of bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate?
bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate has a molecular weight of 466.33 g/mol, XLogP of 3.21, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) 2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate is sourced from PubChem (CID 73325278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).