C23H23ClN4O3 — CID 73327126
3-(4-chlorophenyl)-5-methyl-2,4-dioxo-N-(3-phenylpropyl)-4a,7a-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide (PubChem CID 73327126) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-methyl-2,4-dioxo-N-(3-phenylpropyl)-4a,7a-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-5-methyl-2,4-dioxo-N-(3-phenylpropyl)-4a,7a-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 73327126 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-(4-chlorophenyl)-5-methyl-2,4-dioxo-N-(3-phenylpropyl)-4a,7a-dihydro-1H-pyrrolo[3,2-d]pyrimidine-7-carboxamide |
| SMILES | CN1C=C(C(=O)NCCCc2ccccc2)C2NC(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C23H23ClN4O3/c1-27-14-18(21(29)25-13-5-8-15-6-3-2-4-7-15)19-20(27)22(30)28(23(31)26-19)17-11-9-16(24)10-12-17/h2-4,6-7,9-12,14,19-20H,5,8,13H2,1H3,(H,25,29)(H,26,31) |
| InChIKey | YVJVQHRZXMNDKV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|