C18H21N6O2+ — CID 73328289
1,3-dimethyl-8-(4-methylphenyl)-5-propan-2-yl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione (PubChem CID 73328289) has the molecular formula C18H21N6O2+ and a molecular weight of 353.41 g/mol. Its IUPAC name is 1,3-dimethyl-8-(4-methylphenyl)-5-propan-2-yl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione.
| Compound Name | 1,3-dimethyl-8-(4-methylphenyl)-5-propan-2-yl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73328289 |
| Molecular Formula | C18H21N6O2+ |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1,3-dimethyl-8-(4-methylphenyl)-5-propan-2-yl-4aH-purino[8,9-c][1,2,4]triazol-1-ium-2,4-dione |
| SMILES | Cc1ccc(-c2nnc3n2C2=[N+](C)C(=O)N(C)C(=O)C2N3C(C)C)cc1 |
| InChI | InChI=1S/C18H21N6O2/c1-10(2)23-13-15(21(4)18(26)22(5)16(13)25)24-14(19-20-17(23)24)12-8-6-11(3)7-9-12/h6-10,13H,1-5H3/q+1 |
| InChIKey | MKTGKGXXSWFAHE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|