C12H15N4O3+ — CID 73328484
2-ethyl-4,7,8-trimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione (PubChem CID 73328484) has the molecular formula C12H15N4O3+ and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-ethyl-4,7,8-trimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione.
| Compound Name | 2-ethyl-4,7,8-trimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73328484 |
| Molecular Formula | C12H15N4O3+ |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-ethyl-4,7,8-trimethyl-9aH-purino[8,7-b][1,3]oxazol-9-ium-1,3-dione |
| SMILES | CCN1C(=O)C2C(=Nc3oc(C)c(C)[n+]32)N(C)C1=O |
| InChI | InChI=1S/C12H15N4O3/c1-5-15-10(17)8-9(14(4)12(15)18)13-11-16(8)6(2)7(3)19-11/h8H,5H2,1-4H3/q+1 |
| InChIKey | PQMKLFPJMVKDAV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|