About 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione
8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione (PubChem CID 73328555) has the molecular formula C11H16BrN4O2+
and a molecular weight of 316.18 g/mol. Its IUPAC name is 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione.
Molecular Properties
| Compound Name | 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione |
| PubChem CID | 73328555 |
| Molecular Formula | C11H16BrN4O2+ |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(C)C[N+]1=C(Br)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C11H16BrN4O2/c1-6(2)5-16-7-8(13-10(16)12)14(3)11(18)15(4)9(7)17/h6-7H,5H2,1-4H3/q+1 |
| InChIKey | CGKKABPUWYZNGK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione?
The IUPAC name of 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione (CID 73328555) is 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione.
What is the SMILES notation for 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione?
The canonical SMILES for 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione is CC(C)C[N+]1=C(Br)N=C2C1C(=O)N(C)C(=O)N2C.
What is the InChIKey of 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione?
The InChIKey is CGKKABPUWYZNGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrN4O2/c1-6(2)5-16-7-8(13-10(16)12)14(3)11(18)15(4)9(7)17/h6-7H,5H2,1-4H3/q+1.
What are the key properties of 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione?
8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione has a molecular weight of 316.18 g/mol, XLogP of 0.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1,3-dimethyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione is sourced from PubChem (CID 73328555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).