C23H23F3N6O5S — CID 73329317
2-[[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 73329317) has the molecular formula C23H23F3N6O5S and a molecular weight of 552.54 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 73329317 |
| Molecular Formula | C23H23F3N6O5S |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 2-[[1,3-dimethyl-7-(4-nitrophenyl)-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN1C(=O)C2C(SCC(=O)Nc3ccccc3C(F)(F)F)NC(c3ccc([N+](=O)[O-])cc3)NC2N(C)C1=O |
| InChI | InChI=1S/C23H23F3N6O5S/c1-30-19-17(21(34)31(2)22(30)35)20(29-18(28-19)12-7-9-13(10-8-12)32(36)37)38-11-16(33)27-15-6-4-3-5-14(15)23(24,25)26/h3-10,17-20,28-29H,11H2,1-2H3,(H,27,33) |
| InChIKey | VEGQHPYJNDADGS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|