C17H12BrClFN3O3 — CID 73329498
N-(3-bromophenyl)-1-(3-chloro-4-fluorophenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 73329498) has the molecular formula C17H12BrClFN3O3 and a molecular weight of 440.66 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-(3-chloro-4-fluorophenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(3-bromophenyl)-1-(3-chloro-4-fluorophenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 73329498 |
| Molecular Formula | C17H12BrClFN3O3 |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | N-(3-bromophenyl)-1-(3-chloro-4-fluorophenyl)-2,6-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CNC(=O)N(c2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H12BrClFN3O3/c18-9-2-1-3-10(6-9)22-15(24)12-8-21-17(26)23(16(12)25)11-4-5-14(20)13(19)7-11/h1-7,12H,8H2,(H,21,26)(H,22,24) |
| InChIKey | HOGTWCDOUNPWIP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|