C17H21N5O2S — CID 73330060
2-[(5,6-dimethyl-7-oxo-8,8a-dihydro-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 73330060) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-7-oxo-8,8a-dihydro-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(5,6-dimethyl-7-oxo-8,8a-dihydro-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 73330060 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[(5,6-dimethyl-7-oxo-8,8a-dihydro-1H-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | CC1=C(C)N2C(SCC(=O)NCCc3ccccc3)=NNC2NC1=O |
| InChI | InChI=1S/C17H21N5O2S/c1-11-12(2)22-16(19-15(11)24)20-21-17(22)25-10-14(23)18-9-8-13-6-4-3-5-7-13/h3-7,16,20H,8-10H2,1-2H3,(H,18,23)(H,19,24) |
| InChIKey | UKEQKOOXSBZCNK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |