C12H15N3O3S — CID 73330132
5-methyl-4-[(3-nitrophenyl)methylsulfanyl]-1,3-diazinan-2-one (PubChem CID 73330132) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 5-methyl-4-[(3-nitrophenyl)methylsulfanyl]-1,3-diazinan-2-one.
| Compound Name | 5-methyl-4-[(3-nitrophenyl)methylsulfanyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 73330132 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-methyl-4-[(3-nitrophenyl)methylsulfanyl]-1,3-diazinan-2-one |
| SMILES | CC1CNC(=O)NC1SCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O3S/c1-8-6-13-12(16)14-11(8)19-7-9-3-2-4-10(5-9)15(17)18/h2-5,8,11H,6-7H2,1H3,(H2,13,14,16) |
| InChIKey | JVPZHJGVWNMPDB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|