C14H17NO3 — CID 73330293
(3aS,10aR)-6-methyl-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f]isoindole-1,3,7-trione (PubChem CID 73330293) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (3aS,10aR)-6-methyl-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f]isoindole-1,3,7-trione.
| Compound Name | (3aS,10aR)-6-methyl-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f]isoindole-1,3,7-trione |
|---|---|
| PubChem CID | 73330293 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (3aS,10aR)-6-methyl-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f]isoindole-1,3,7-trione |
| SMILES | CC1CC2=C(CCC1=O)C[C@H]1C(=O)NC(=O)[C@H]1C2 |
| InChI | InChI=1S/C14H17NO3/c1-7-4-9-6-11-10(13(17)15-14(11)18)5-8(9)2-3-12(7)16/h7,10-11H,2-6H2,1H3,(H,15,17,18)/t7?,10-,11+/m1/s1 |
| InChIKey | SMOSTBWXVSJRAA-RFSDDRETSA-N |
| XLogP | 1.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|