C13H14O4 — CID 73330299
(3aR,10aS)-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f][2]benzofuran-1,3,7-trione (PubChem CID 73330299) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (3aR,10aS)-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f][2]benzofuran-1,3,7-trione.
| Compound Name | (3aR,10aS)-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f][2]benzofuran-1,3,7-trione |
|---|---|
| PubChem CID | 73330299 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (3aR,10aS)-3a,4,5,6,8,9,10,10a-octahydrocyclohepta[f][2]benzofuran-1,3,7-trione |
| SMILES | O=C1CCC2=C(CC1)C[C@H]1C(=O)OC(=O)[C@H]1C2 |
| InChI | InChI=1S/C13H14O4/c14-9-3-1-7-5-10-11(6-8(7)2-4-9)13(16)17-12(10)15/h10-11H,1-6H2/t10-,11+ |
| InChIKey | LFHMDXJUEYGTBZ-PHIMTYICSA-N |
| XLogP | 1.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|