C14H22OSi — CID 73330305
3-trimethylsilyl-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one (PubChem CID 73330305) has the molecular formula C14H22OSi and a molecular weight of 234.41 g/mol. Its IUPAC name is 3-trimethylsilyl-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one.
| Compound Name | 3-trimethylsilyl-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one |
|---|---|
| PubChem CID | 73330305 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-trimethylsilyl-1,4,5,6,8,9-hexahydrobenzo[7]annulen-7-one |
| SMILES | C[Si](C)(C)C1=CCC2=C(CCC(=O)CC2)C1 |
| InChI | InChI=1S/C14H22OSi/c1-16(2,3)14-9-6-11-4-7-13(15)8-5-12(11)10-14/h9H,4-8,10H2,1-3H3 |
| InChIKey | QVLRSCPFWTYOFE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|