C15H18O5 — CID 73330319
dimethyl 7-oxo-1,4,5,6,8,9-hexahydrobenzo[7]annulene-2,3-dicarboxylate (PubChem CID 73330319) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is dimethyl 7-oxo-1,4,5,6,8,9-hexahydrobenzo[7]annulene-2,3-dicarboxylate.
| Compound Name | dimethyl 7-oxo-1,4,5,6,8,9-hexahydrobenzo[7]annulene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 73330319 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | dimethyl 7-oxo-1,4,5,6,8,9-hexahydrobenzo[7]annulene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)CC2=C(CCC(=O)CC2)C1 |
| InChI | InChI=1S/C15H18O5/c1-19-14(17)12-7-9-3-5-11(16)6-4-10(9)8-13(12)15(18)20-2/h3-8H2,1-2H3 |
| InChIKey | GOSIHIZVEQFABN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|