C16H26N2O3 — CID 7333057
(1S,5R)-1,8,8-trimethyl-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 7333057) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (1S,5R)-1,8,8-trimethyl-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-1,8,8-trimethyl-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 7333057 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (1S,5R)-1,8,8-trimethyl-3-(2-morpholin-4-ylethyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)N(CCN1CCOCC1)C2=O |
| InChI | InChI=1S/C16H26N2O3/c1-15(2)12-4-5-16(15,3)14(20)18(13(12)19)7-6-17-8-10-21-11-9-17/h12H,4-11H2,1-3H3/t12-,16+/m0/s1 |
| InChIKey | DASPDUNBFCHKJN-BLLLJJGKSA-N |
| XLogP | 1.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|