About CID 73331486
CID 73331486 (PubChem CID 73331486) has the molecular formula C25H32N4O4
and a molecular weight of 452.56 g/mol.
Molecular Properties
| Compound Name | CID 73331486 |
| PubChem CID | 73331486 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | — |
| SMILES | CC[C@@H]1C[C@@]2(Cc3ccc(C#N)cc3[C@]23N=C(N)N(C[C@H]2COCCO2)C3=O)C[C@H](C)[C@H]1O |
| InChI | InChI=1S/C25H32N4O4/c1-3-17-10-24(9-15(2)21(17)30)11-18-5-4-16(12-26)8-20(18)25(24)22(31)29(23(27)28-25)13-19-14-32-6-7-33-19/h4-5,8,15,17,19,21,30H,3,6-7,9-11,13-14H2,1-2H3,(H2,27,28)/t15-,17+,19-,21+,24+,25+/m0/s1 |
| InChIKey | CFCBEKLZPVRDQH-PZCOOVOTSA-N |
| XLogP | 1.69 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 73331486 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73331486?
The IUPAC name of CID 73331486 (CID 73331486) is not available.
What is the SMILES notation for CID 73331486?
The canonical SMILES for CID 73331486 is CC[C@@H]1C[C@@]2(Cc3ccc(C#N)cc3[C@]23N=C(N)N(C[C@H]2COCCO2)C3=O)C[C@H](C)[C@H]1O.
What is the InChIKey of CID 73331486?
The InChIKey is CFCBEKLZPVRDQH-PZCOOVOTSA-N. The full InChI is InChI=1S/C25H32N4O4/c1-3-17-10-24(9-15(2)21(17)30)11-18-5-4-16(12-26)8-20(18)25(24)22(31)29(23(27)28-25)13-19-14-32-6-7-33-19/h4-5,8,15,17,19,21,30H,3,6-7,9-11,13-14H2,1-2H3,(H2,27,28)/t15-,17+,19-,21+,24+,25+/m0/s1.
What are the key properties of CID 73331486?
CID 73331486 has a molecular weight of 452.56 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73331486 is sourced from PubChem (CID 73331486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).