C17H23N2+ — CID 7333150
(2S)-2-tert-butyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine (PubChem CID 7333150) has the molecular formula C17H23N2+ and a molecular weight of 255.38 g/mol. Its IUPAC name is (2S)-2-tert-butyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine.
| Compound Name | (2S)-2-tert-butyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine |
|---|---|
| PubChem CID | 7333150 |
| Molecular Formula | C17H23N2+ |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | (2S)-2-tert-butyl-1,2,3,4-tetrahydroacridin-10-ium-9-amine |
| SMILES | CC(C)(C)[C@H]1CCc2[nH+]c3ccccc3c(N)c2C1 |
| InChI | InChI=1S/C17H22N2/c1-17(2,3)11-8-9-15-13(10-11)16(18)12-6-4-5-7-14(12)19-15/h4-7,11H,8-10H2,1-3H3,(H2,18,19)/p+1/t11-/m0/s1 |
| InChIKey | DFHPXBMELNUPRG-NSHDSACASA-O |
| XLogP | 3.39 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |