C25H31N3O — CID 73331529
1-pyridin-4-yl-2-(6,6,8,10-tetramethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol (PubChem CID 73331529) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-pyridin-4-yl-2-(6,6,8,10-tetramethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol.
| Compound Name | 1-pyridin-4-yl-2-(6,6,8,10-tetramethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol |
|---|---|
| PubChem CID | 73331529 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 1-pyridin-4-yl-2-(6,6,8,10-tetramethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)ethanol |
| SMILES | Cc1cc(C)c2c(c1)c1c(n2CC(O)c2ccncc2)C(C)(C)CN2CCCC12 |
| InChI | InChI=1S/C25H31N3O/c1-16-12-17(2)23-19(13-16)22-20-6-5-11-27(20)15-25(3,4)24(22)28(23)14-21(29)18-7-9-26-10-8-18/h7-10,12-13,20-21,29H,5-6,11,14-15H2,1-4H3 |
| InChIKey | VAPCHYZQSMTAOW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |