C25H24N6O4S — CID 73331620
7-[(4E)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid (PubChem CID 73331620) has the molecular formula C25H24N6O4S and a molecular weight of 504.57 g/mol. Its IUPAC name is 7-[(4E)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-[(4E)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 73331620 |
| Molecular Formula | C25H24N6O4S |
| Molecular Weight | 504.57 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 7-[(4E)-3-(aminomethyl)-3-methyl-4-phenylmethoxyiminopyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CC1(CN)CN(c2ccc3c(=O)c(C(=O)O)cn(-c4nccs4)c3n2)C/C1=N/OCc1ccccc1 |
| InChI | InChI=1S/C25H24N6O4S/c1-25(14-26)15-30(12-19(25)29-35-13-16-5-3-2-4-6-16)20-8-7-17-21(32)18(23(33)34)11-31(22(17)28-20)24-27-9-10-36-24/h2-11H,12-15,26H2,1H3,(H,33,34)/b29-19- |
| InChIKey | FPNKNTDOJVKNST-CEUNXORHSA-N |
| XLogP | 2.90 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|