C25H38BrNO4S — CID 73332077
ethyl (1R,2R,3'R,4'R,5'S)-6-bromo-1-[[(R)-tert-butylsulfinyl]amino]-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 73332077) has the molecular formula C25H38BrNO4S and a molecular weight of 528.55 g/mol. Its IUPAC name is ethyl (1R,2R,3'R,4'R,5'S)-6-bromo-1-[[(R)-tert-butylsulfinyl]amino]-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
| Compound Name | ethyl (1R,2R,3'R,4'R,5'S)-6-bromo-1-[[(R)-tert-butylsulfinyl]amino]-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 73332077 |
| Molecular Formula | C25H38BrNO4S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | ethyl (1R,2R,3'R,4'R,5'S)-6-bromo-1-[[(R)-tert-butylsulfinyl]amino]-3'-ethyl-4'-methoxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(N[S@](=O)C(C)(C)C)c2cc(Br)ccc2C[C@@]12C[C@@H](CC)[C@H](OC)[C@@H](C)C2 |
| InChI | InChI=1S/C25H38BrNO4S/c1-8-17-14-24(13-16(3)21(17)30-7)15-18-10-11-19(26)12-20(18)25(24,22(28)31-9-2)27-32(29)23(4,5)6/h10-12,16-17,21,27H,8-9,13-15H2,1-7H3/t16-,17+,21+,24+,25+,32+/m0/s1 |
| InChIKey | KZRWCBAXWWTFIY-APHKOZPXSA-N |
| XLogP | 5.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |