C21H28N2O3 — CID 73332232
ethyl (1R,2R,3'R,4'R,5'S)-1-amino-6-cyano-3'-ethyl-4'-hydroxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate (PubChem CID 73332232) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is ethyl (1R,2R,3'R,4'R,5'S)-1-amino-6-cyano-3'-ethyl-4'-hydroxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate.
| Compound Name | ethyl (1R,2R,3'R,4'R,5'S)-1-amino-6-cyano-3'-ethyl-4'-hydroxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 73332232 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | ethyl (1R,2R,3'R,4'R,5'S)-1-amino-6-cyano-3'-ethyl-4'-hydroxy-5'-methylspiro[3H-indene-2,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(N)c2cc(C#N)ccc2C[C@@]12C[C@@H](CC)[C@H](O)[C@@H](C)C2 |
| InChI | InChI=1S/C21H28N2O3/c1-4-15-10-20(9-13(3)18(15)24)11-16-7-6-14(12-22)8-17(16)21(20,23)19(25)26-5-2/h6-8,13,15,18,24H,4-5,9-11,23H2,1-3H3/t13-,15+,18+,20+,21+/m0/s1 |
| InChIKey | BLDCSTQKZDBTEL-QBUXFNRASA-N |
| XLogP | 2.63 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |