C22H22F3N5O3S — CID 73332429
3-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]phenyl]-4,4,4-trifluoro-3-hydroxybutanenitrile (PubChem CID 73332429) has the molecular formula C22H22F3N5O3S and a molecular weight of 493.51 g/mol. Its IUPAC name is 3-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]phenyl]-4,4,4-trifluoro-3-hydroxybutanenitrile.
| Compound Name | 3-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]phenyl]-4,4,4-trifluoro-3-hydroxybutanenitrile |
|---|---|
| PubChem CID | 73332429 |
| Molecular Formula | C22H22F3N5O3S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 3-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]phenyl]-4,4,4-trifluoro-3-hydroxybutanenitrile |
| SMILES | CC#C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ccc(C(O)(CC#N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F3N5O3S/c1-2-3-18-15-29(34(32,33)19-8-9-20(27)28-14-19)12-13-30(18)17-6-4-16(5-7-17)21(31,10-11-26)22(23,24)25/h4-9,14,18,31H,10,12-13,15H2,1H3,(H2,27,28)/t18-,21?/m0/s1 |
| InChIKey | MBZDOAMNOCSICC-YMXDCFFPSA-N |
| XLogP | 2.23 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|