C24H23N3O5 — CID 73332715
1-[[3-(2-methoxyethoxy)phenyl]methyl]-5-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]pyridin-2-one (PubChem CID 73332715) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is 1-[[3-(2-methoxyethoxy)phenyl]methyl]-5-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]pyridin-2-one.
| Compound Name | 1-[[3-(2-methoxyethoxy)phenyl]methyl]-5-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]pyridin-2-one |
|---|---|
| PubChem CID | 73332715 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-[[3-(2-methoxyethoxy)phenyl]methyl]-5-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]pyridin-2-one |
| SMILES | COCCOc1cccc(Cn2cc(-c3noc(-c4ccc(OC)cc4)n3)ccc2=O)c1 |
| InChI | InChI=1S/C24H23N3O5/c1-29-12-13-31-21-5-3-4-17(14-21)15-27-16-19(8-11-22(27)28)23-25-24(32-26-23)18-6-9-20(30-2)10-7-18/h3-11,14,16H,12-13,15H2,1-2H3 |
| InChIKey | ALMUTYGKNFTJDU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|