C33H36ClN3O2S — CID 73332791
3-chloro-N-[4-(hexanoylamino)cyclohexyl]-N-[(3-pyridin-4-ylphenyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 73332791) has the molecular formula C33H36ClN3O2S and a molecular weight of 574.19 g/mol. Its IUPAC name is 3-chloro-N-[4-(hexanoylamino)cyclohexyl]-N-[(3-pyridin-4-ylphenyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-(hexanoylamino)cyclohexyl]-N-[(3-pyridin-4-ylphenyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 73332791 |
| Molecular Formula | C33H36ClN3O2S |
| Molecular Weight | 574.19 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 3-chloro-N-[4-(hexanoylamino)cyclohexyl]-N-[(3-pyridin-4-ylphenyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCCCCC(=O)NC1CCC(N(Cc2cccc(-c3ccncc3)c2)C(=O)c2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C33H36ClN3O2S/c1-2-3-4-12-30(38)36-26-13-15-27(16-14-26)37(33(39)32-31(34)28-10-5-6-11-29(28)40-32)22-23-8-7-9-25(21-23)24-17-19-35-20-18-24/h5-11,17-21,26-27H,2-4,12-16,22H2,1H3,(H,36,38) |
| InChIKey | STWCPNVBBKJKRV-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.19 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|