C16H20FNO — CID 73332874
(9R,10S)-5-fluoro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene-9-carbaldehyde (PubChem CID 73332874) has the molecular formula C16H20FNO and a molecular weight of 261.34 g/mol. Its IUPAC name is (9R,10S)-5-fluoro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene-9-carbaldehyde.
| Compound Name | (9R,10S)-5-fluoro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene-9-carbaldehyde |
|---|---|
| PubChem CID | 73332874 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (9R,10S)-5-fluoro-1-azatricyclo[8.6.0.02,7]hexadeca-2(7),3,5-triene-9-carbaldehyde |
| SMILES | O=C[C@@H]1Cc2cc(F)ccc2N2CCCCCC[C@@H]12 |
| InChI | InChI=1S/C16H20FNO/c17-14-6-7-16-12(10-14)9-13(11-19)15-5-3-1-2-4-8-18(15)16/h6-7,10-11,13,15H,1-5,8-9H2/t13-,15-/m0/s1 |
| InChIKey | OCMODYBXRBAURI-ZFWWWQNUSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|