C34H39N2OP — CID 73332958
(1R,3aS)-1-(2-dicyclohexylphosphanylphenyl)-2-phenyl-3a,4-dihydro-1H-imidazo[1,5-a]indol-3-one (PubChem CID 73332958) has the molecular formula C34H39N2OP and a molecular weight of 522.67 g/mol. Its IUPAC name is (1R,3aS)-1-(2-dicyclohexylphosphanylphenyl)-2-phenyl-3a,4-dihydro-1H-imidazo[1,5-a]indol-3-one.
| Compound Name | (1R,3aS)-1-(2-dicyclohexylphosphanylphenyl)-2-phenyl-3a,4-dihydro-1H-imidazo[1,5-a]indol-3-one |
|---|---|
| PubChem CID | 73332958 |
| Molecular Formula | C34H39N2OP |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | (1R,3aS)-1-(2-dicyclohexylphosphanylphenyl)-2-phenyl-3a,4-dihydro-1H-imidazo[1,5-a]indol-3-one |
| SMILES | O=C1[C@@H]2Cc3ccccc3N2[C@@H](c2ccccc2P(C2CCCCC2)C2CCCCC2)N1c1ccccc1 |
| InChI | InChI=1S/C34H39N2OP/c37-34-31-24-25-14-10-12-22-30(25)36(31)33(35(34)26-15-4-1-5-16-26)29-21-11-13-23-32(29)38(27-17-6-2-7-18-27)28-19-8-3-9-20-28/h1,4-5,10-16,21-23,27-28,31,33H,2-3,6-9,17-20,24H2/t31-,33-/m0/s1 |
| InChIKey | MPAFLJBGSXSSOL-WEZIJMHWSA-N |
| XLogP | 7.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|