C21H24N4O7 — CID 73333093
1,5-bis(3,4,5-trimethoxyphenyl)triazole-4-carboxamide (PubChem CID 73333093) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is 1,5-bis(3,4,5-trimethoxyphenyl)triazole-4-carboxamide.
| Compound Name | 1,5-bis(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 73333093 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1,5-bis(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1cc(-c2c(C(N)=O)nnn2-c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N4O7/c1-27-13-7-11(8-14(28-2)19(13)31-5)18-17(21(22)26)23-24-25(18)12-9-15(29-3)20(32-6)16(10-12)30-4/h7-10H,1-6H3,(H2,22,26) |
| InChIKey | QZZHJHZNLFRILP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |