About 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide
5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide (PubChem CID 73333094) has the molecular formula C19H20N4O5
and a molecular weight of 384.39 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
| PubChem CID | 73333094 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide |
| SMILES | COc1ccc(-c2c(C(N)=O)nnn2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H20N4O5/c1-25-13-7-5-11(6-8-13)17-16(19(20)24)21-22-23(17)12-9-14(26-2)18(28-4)15(10-12)27-3/h5-10H,1-4H3,(H2,20,24) |
| InChIKey | GZOVKXTXKMUHLY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide?
The IUPAC name of 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide (CID 73333094) is 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide.
What is the SMILES notation for 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide?
The canonical SMILES for 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide is COc1ccc(-c2c(C(N)=O)nnn2-c2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide?
The InChIKey is GZOVKXTXKMUHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O5/c1-25-13-7-5-11(6-8-13)17-16(19(20)24)21-22-23(17)12-9-14(26-2)18(28-4)15(10-12)27-3/h5-10H,1-4H3,(H2,20,24).
What are the key properties of 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide?
5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide has a molecular weight of 384.39 g/mol, XLogP of 2.07, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxamide is sourced from PubChem (CID 73333094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).