About methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate
methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate (PubChem CID 73333191) has the molecular formula C20H21N3O6
and a molecular weight of 399.40 g/mol. Its IUPAC name is methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate |
| PubChem CID | 73333191 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(-c2cc(OC)c(OC)c(OC)c2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H21N3O6/c1-25-14-8-6-12(7-9-14)18-17(20(24)29-5)21-22-23(18)13-10-15(26-2)19(28-4)16(11-13)27-3/h6-11H,1-5H3 |
| InChIKey | PLIMGILENGQOOC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate?
The IUPAC name of methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate (CID 73333191) is methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate.
What is the SMILES notation for methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate?
The canonical SMILES for methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate is COC(=O)c1nnn(-c2cc(OC)c(OC)c(OC)c2)c1-c1ccc(OC)cc1.
What is the InChIKey of methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate?
The InChIKey is PLIMGILENGQOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O6/c1-25-14-8-6-12(7-9-14)18-17(20(24)29-5)21-22-23(18)13-10-15(26-2)19(28-4)16(11-13)27-3/h6-11H,1-5H3.
What are the key properties of methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate?
methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate has a molecular weight of 399.40 g/mol, XLogP of 2.76, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)triazole-4-carboxylate is sourced from PubChem (CID 73333191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).