About 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene
7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene (PubChem CID 73333235) has the molecular formula C23H26O3
and a molecular weight of 350.46 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene.
Molecular Properties
| Compound Name | 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene |
| PubChem CID | 73333235 |
| Molecular Formula | C23H26O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene |
| SMILES | COc1cc2c(cc1C(C)OC/C=C/c1ccccc1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H26O3/c1-17(25-14-8-11-18-9-6-5-7-10-18)20-15-19-12-13-23(2,3)26-21(19)16-22(20)24-4/h5-13,15-17H,14H2,1-4H3/b11-8+ |
| InChIKey | WCUJEGHLDNDLPJ-DHZHZOJOSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene?
The IUPAC name of 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene (CID 73333235) is 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene.
What is the SMILES notation for 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene?
The canonical SMILES for 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene is COc1cc2c(cc1C(C)OC/C=C/c1ccccc1)C=CC(C)(C)O2.
What is the InChIKey of 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene?
The InChIKey is WCUJEGHLDNDLPJ-DHZHZOJOSA-N. The full InChI is InChI=1S/C23H26O3/c1-17(25-14-8-11-18-9-6-5-7-10-18)20-15-19-12-13-23(2,3)26-21(19)16-22(20)24-4/h5-13,15-17H,14H2,1-4H3/b11-8+.
What are the key properties of 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene?
7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene has a molecular weight of 350.46 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,2-dimethyl-6-[1-[(E)-3-phenylprop-2-enoxy]ethyl]chromene is sourced from PubChem (CID 73333235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).