C23H25NO3 — CID 73333328
(E)-N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylprop-2-enamide (PubChem CID 73333328) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (E)-N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 73333328 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (E)-N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylprop-2-enamide |
| SMILES | COc1cc2c(cc1C(C)NC(=O)/C=C/c1ccccc1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H25NO3/c1-16(24-22(25)11-10-17-8-6-5-7-9-17)19-14-18-12-13-23(2,3)27-20(18)15-21(19)26-4/h5-16H,1-4H3,(H,24,25)/b11-10+ |
| InChIKey | QTTFZKVHOYSYCT-ZHACJKMWSA-N |
| XLogP | 4.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|