C21H25NO2 — CID 73333329
N-benzyl-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethanamine (PubChem CID 73333329) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-benzyl-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethanamine.
| Compound Name | N-benzyl-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethanamine |
|---|---|
| PubChem CID | 73333329 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-benzyl-1-(7-methoxy-2,2-dimethylchromen-6-yl)ethanamine |
| SMILES | COc1cc2c(cc1C(C)NCc1ccccc1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C21H25NO2/c1-15(22-14-16-8-6-5-7-9-16)18-12-17-10-11-21(2,3)24-19(17)13-20(18)23-4/h5-13,15,22H,14H2,1-4H3 |
| InChIKey | YYHBOUVNIMWRMK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |