C22H27NO2 — CID 73333330
1-(7-methoxy-2,2-dimethylchromen-6-yl)-N-(2-phenylethyl)ethanamine (PubChem CID 73333330) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-(7-methoxy-2,2-dimethylchromen-6-yl)-N-(2-phenylethyl)ethanamine.
| Compound Name | 1-(7-methoxy-2,2-dimethylchromen-6-yl)-N-(2-phenylethyl)ethanamine |
|---|---|
| PubChem CID | 73333330 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-(7-methoxy-2,2-dimethylchromen-6-yl)-N-(2-phenylethyl)ethanamine |
| SMILES | COc1cc2c(cc1C(C)NCCc1ccccc1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C22H27NO2/c1-16(23-13-11-17-8-6-5-7-9-17)19-14-18-10-12-22(2,3)25-20(18)15-21(19)24-4/h5-10,12,14-16,23H,11,13H2,1-4H3 |
| InChIKey | QFZDZMGQABEGRH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |