C23H29NO2 — CID 73333331
N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylpropan-1-amine (PubChem CID 73333331) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylpropan-1-amine.
| Compound Name | N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 73333331 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-3-phenylpropan-1-amine |
| SMILES | COc1cc2c(cc1C(C)NCCCc1ccccc1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C23H29NO2/c1-17(24-14-8-11-18-9-6-5-7-10-18)20-15-19-12-13-23(2,3)26-21(19)16-22(20)25-4/h5-7,9-10,12-13,15-17,24H,8,11,14H2,1-4H3 |
| InChIKey | XGJMHBHRVKZMEX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|