C24H31NO2 — CID 73333332
N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-4-phenylbutan-1-amine (PubChem CID 73333332) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-4-phenylbutan-1-amine.
| Compound Name | N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 73333332 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | N-[1-(7-methoxy-2,2-dimethylchromen-6-yl)ethyl]-4-phenylbutan-1-amine |
| SMILES | COc1cc2c(cc1C(C)NCCCCc1ccccc1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C24H31NO2/c1-18(25-15-9-8-12-19-10-6-5-7-11-19)21-16-20-13-14-24(2,3)27-22(20)17-23(21)26-4/h5-7,10-11,13-14,16-18,25H,8-9,12,15H2,1-4H3 |
| InChIKey | WAZVBMRNWDQKGT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|