C28H20F3N3S — CID 73333405
(13E)-6,8-bis(4-fluorophenyl)-13-[(4-fluorophenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene (PubChem CID 73333405) has the molecular formula C28H20F3N3S and a molecular weight of 487.55 g/mol. Its IUPAC name is (13E)-6,8-bis(4-fluorophenyl)-13-[(4-fluorophenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene.
| Compound Name | (13E)-6,8-bis(4-fluorophenyl)-13-[(4-fluorophenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene |
|---|---|
| PubChem CID | 73333405 |
| Molecular Formula | C28H20F3N3S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (13E)-6,8-bis(4-fluorophenyl)-13-[(4-fluorophenyl)methylidene]-4-thia-2,7,11-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5-triene |
| SMILES | Fc1ccc(/C=C2\CNCC3=C2N=C2SC=C(c4ccc(F)cc4)N2C3c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H20F3N3S/c29-21-7-1-17(2-8-21)13-20-14-32-15-24-26(20)33-28-34(27(24)19-5-11-23(31)12-6-19)25(16-35-28)18-3-9-22(30)10-4-18/h1-13,16,27,32H,14-15H2/b20-13+ |
| InChIKey | AJCILFHONNNLGQ-DEDYPNTBSA-N |
| XLogP | 6.50 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |