About 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine
1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine (PubChem CID 73333527) has the molecular formula C22H29NO2
and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine.
Molecular Properties
| Compound Name | 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine |
| PubChem CID | 73333527 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine |
| SMILES | COc1cc2c(cc1C(C)NCCc1ccccc1)CCC(C)(C)O2 |
| InChI | InChI=1S/C22H29NO2/c1-16(23-13-11-17-8-6-5-7-9-17)19-14-18-10-12-22(2,3)25-20(18)15-21(19)24-4/h5-9,14-16,23H,10-13H2,1-4H3 |
| InChIKey | YXNHQCHFNKNFBR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine?
The IUPAC name of 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine (CID 73333527) is 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine.
What is the SMILES notation for 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine?
The canonical SMILES for 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine is COc1cc2c(cc1C(C)NCCc1ccccc1)CCC(C)(C)O2.
What is the InChIKey of 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine?
The InChIKey is YXNHQCHFNKNFBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO2/c1-16(23-13-11-17-8-6-5-7-9-17)19-14-18-10-12-22(2,3)25-20(18)15-21(19)24-4/h5-9,14-16,23H,10-13H2,1-4H3.
What are the key properties of 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine?
1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine has a molecular weight of 339.48 g/mol, XLogP of 4.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-N-(2-phenylethyl)ethanamine is sourced from PubChem (CID 73333527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).