C10H8N4O3 — CID 73333697
5-(pyridin-4-yliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 73333697) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 5-(pyridin-4-yliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(pyridin-4-yliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 73333697 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 5-(pyridin-4-yliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/c2ccncc2)C(=O)N1 |
| InChI | InChI=1S/C10H8N4O3/c15-8-7(9(16)14-10(17)13-8)5-12-6-1-3-11-4-2-6/h1-5,7H,(H2,13,14,15,16,17)/b12-5+ |
| InChIKey | SZDVTXIOTXAVOU-LFYBBSHMSA-N |
| XLogP | -0.23 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|