C8H15NO5 — CID 73333773
(3S,4S,4aS,5R,6S,7S,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine-3,4,5,6,7-pentol (PubChem CID 73333773) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (3S,4S,4aS,5R,6S,7S,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine-3,4,5,6,7-pentol.
| Compound Name | (3S,4S,4aS,5R,6S,7S,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine-3,4,5,6,7-pentol |
|---|---|
| PubChem CID | 73333773 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (3S,4S,4aS,5R,6S,7S,7aR)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine-3,4,5,6,7-pentol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H]2NC[C@H](O)[C@@H](O)[C@H]2[C@H]1O |
| InChI | InChI=1S/C8H15NO5/c10-2-1-9-4-3(5(2)11)6(12)8(14)7(4)13/h2-14H,1H2/t2-,3-,4+,5+,6+,7-,8-/m0/s1 |
| InChIKey | WXKXQHPVHZKQGG-CEGGMYBLSA-N |
| XLogP | -3.61 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |