C11H9N3O3 — CID 73333815
5-(phenyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 73333815) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 5-(phenyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(phenyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 73333815 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 5-(phenyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H9N3O3/c15-9-8(10(16)14-11(17)13-9)6-12-7-4-2-1-3-5-7/h1-6,8H,(H2,13,14,15,16,17)/b12-6+ |
| InChIKey | BIWSNRSYSGWOGC-WUXMJOGZSA-N |
| XLogP | 0.37 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|