C11H9N3O4 — CID 73333822
5-[(3-hydroxyphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 73333822) has the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. Its IUPAC name is 5-[(3-hydroxyphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3-hydroxyphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 73333822 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 5-[(3-hydroxyphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/c2cccc(O)c2)C(=O)N1 |
| InChI | InChI=1S/C11H9N3O4/c15-7-3-1-2-6(4-7)12-5-8-9(16)13-11(18)14-10(8)17/h1-5,8,15H,(H2,13,14,16,17,18)/b12-5+ |
| InChIKey | VWMOHDARFHXOSY-LFYBBSHMSA-N |
| XLogP | 0.08 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|