C17H13N3O3 — CID 73333942
5-[(4-phenylphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 73333942) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-[(4-phenylphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-phenylphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 73333942 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-[(4-phenylphenyl)iminomethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(/C=N/c2ccc(-c3ccccc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C17H13N3O3/c21-15-14(16(22)20-17(23)19-15)10-18-13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10,14H,(H2,19,20,21,22,23)/b18-10+ |
| InChIKey | GXYUTLIOFUPGGS-VCHYOVAHSA-N |
| XLogP | 2.04 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|