C29H26O4 — CID 73333943
ethyl 2-[4-(4-hydroxyphenyl)-2-[(4-phenylphenyl)methyl]phenoxy]acetate (PubChem CID 73333943) has the molecular formula C29H26O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is ethyl 2-[4-(4-hydroxyphenyl)-2-[(4-phenylphenyl)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-(4-hydroxyphenyl)-2-[(4-phenylphenyl)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 73333943 |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | ethyl 2-[4-(4-hydroxyphenyl)-2-[(4-phenylphenyl)methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2ccc(O)cc2)cc1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26O4/c1-2-32-29(31)20-33-28-17-14-25(24-12-15-27(30)16-13-24)19-26(28)18-21-8-10-23(11-9-21)22-6-4-3-5-7-22/h3-17,19,30H,2,18,20H2,1H3 |
| InChIKey | OMFYIPSOVAXIFI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |