C25H30N2O5 — CID 73333981
methyl 6-[(4R,5R)-1,3-dibenzyl-5-(hydroxymethyl)-2-oxoimidazolidin-4-yl]-6-oxohexanoate (PubChem CID 73333981) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is methyl 6-[(4R,5R)-1,3-dibenzyl-5-(hydroxymethyl)-2-oxoimidazolidin-4-yl]-6-oxohexanoate.
| Compound Name | methyl 6-[(4R,5R)-1,3-dibenzyl-5-(hydroxymethyl)-2-oxoimidazolidin-4-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 73333981 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | methyl 6-[(4R,5R)-1,3-dibenzyl-5-(hydroxymethyl)-2-oxoimidazolidin-4-yl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)[C@H]1[C@H](CO)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O5/c1-32-23(30)15-9-8-14-22(29)24-21(18-28)26(16-19-10-4-2-5-11-19)25(31)27(24)17-20-12-6-3-7-13-20/h2-7,10-13,21,24,28H,8-9,14-18H2,1H3/t21-,24+/m0/s1 |
| InChIKey | NKLRLVJBJAFYAK-XUZZJYLKSA-N |
| XLogP | 3.16 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|