C5H6N4O3 — CID 73334132
5-[(E)-hydrazinylidenemethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 73334132) has the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. Its IUPAC name is 5-[(E)-hydrazinylidenemethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-hydrazinylidenemethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 73334132 |
| Molecular Formula | C5H6N4O3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 5-[(E)-hydrazinylidenemethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | N/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C5H6N4O3/c6-7-1-2-3(10)8-5(12)9-4(2)11/h1-2H,6H2,(H2,8,9,10,11,12)/b7-1+ |
| InChIKey | NTPVENJLTFSAGR-LREOWRDNSA-N |
| XLogP | -2.09 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|