C8H12N4O3 — CID 73334135
5-ethanehydrazonoyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 73334135) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-ethanehydrazonoyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethanehydrazonoyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 73334135 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 5-ethanehydrazonoyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C/C(=N\N)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C8H12N4O3/c1-4(10-9)5-6(13)11(2)8(15)12(3)7(5)14/h5H,9H2,1-3H3/b10-4+ |
| InChIKey | SKUDCNJWFNNLEK-ONNFQVAWSA-N |
| XLogP | -1.01 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|