C6H8N4O3 — CID 73334136
5-[(E)-(methylhydrazinylidene)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 73334136) has the molecular formula C6H8N4O3 and a molecular weight of 184.16 g/mol. Its IUPAC name is 5-[(E)-(methylhydrazinylidene)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-(methylhydrazinylidene)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 73334136 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 5-[(E)-(methylhydrazinylidene)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H8N4O3/c1-7-8-2-3-4(11)9-6(13)10-5(3)12/h2-3,7H,1H3,(H2,9,10,11,12,13)/b8-2+ |
| InChIKey | LAJOREBCBSRXSL-KRXBUXKQSA-N |
| XLogP | -1.83 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|